C17H20N2S — CID 11818469
1,3-bis[(1R)-1-phenylethyl]thiourea (PubChem CID 11818469) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 1,3-bis[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1,3-bis[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 11818469 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1,3-bis[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@@H](NC(=S)N[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2S/c1-13(15-9-5-3-6-10-15)18-17(20)19-14(2)16-11-7-4-8-12-16/h3-14H,1-2H3,(H2,18,19,20)/t13-,14-/m1/s1 |
| InChIKey | OCIUEYSMBBAERM-ZIAGYGMSSA-N |
| XLogP | 3.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|