C16H18F3N3 — CID 118185005
(5R,6S,8S)-5-methyl-6-phenyl-3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine (PubChem CID 118185005) has the molecular formula C16H18F3N3 and a molecular weight of 309.34 g/mol. Its IUPAC name is (5R,6S,8S)-5-methyl-6-phenyl-3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine.
| Compound Name | (5R,6S,8S)-5-methyl-6-phenyl-3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 118185005 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (5R,6S,8S)-5-methyl-6-phenyl-3-(2,2,2-trifluoroethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-amine |
| SMILES | C[C@@H]1[C@H](c2ccccc2)C[C@H](N)c2ncc(CC(F)(F)F)n21 |
| InChI | InChI=1S/C16H18F3N3/c1-10-13(11-5-3-2-4-6-11)7-14(20)15-21-9-12(22(10)15)8-16(17,18)19/h2-6,9-10,13-14H,7-8,20H2,1H3/t10-,13-,14+/m1/s1 |
| InChIKey | CPRGBFGOMLVVBM-HONMWMINSA-N |
| XLogP | 3.74 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |