C24H41NO3 — CID 118185013
2-[methyl-[(9E,12E)-octadeca-9,12-dienoyl]amino]ethyl prop-2-enoate (PubChem CID 118185013) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 2-[methyl-[(9E,12E)-octadeca-9,12-dienoyl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[methyl-[(9E,12E)-octadeca-9,12-dienoyl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 118185013 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | 2-[methyl-[(9E,12E)-octadeca-9,12-dienoyl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)C(=O)CCCCCCC/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C24H41NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(26)25(3)21-22-28-24(27)5-2/h5,9-10,12-13H,2,4,6-8,11,14-22H2,1,3H3/b10-9+,13-12+ |
| InChIKey | IJJVXNBFJRMNHH-OKLKQMLOSA-N |
| XLogP | 5.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|