C18H18N2O — CID 118185068
2-amino-4-(1,2,3,4-tetrahydrocarbazol-9-yl)phenol (PubChem CID 118185068) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-amino-4-(1,2,3,4-tetrahydrocarbazol-9-yl)phenol.
| Compound Name | 2-amino-4-(1,2,3,4-tetrahydrocarbazol-9-yl)phenol |
|---|---|
| PubChem CID | 118185068 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-amino-4-(1,2,3,4-tetrahydrocarbazol-9-yl)phenol |
| SMILES | Nc1cc(-n2c3c(c4ccccc42)CCCC3)ccc1O |
| InChI | InChI=1S/C18H18N2O/c19-15-11-12(9-10-18(15)21)20-16-7-3-1-5-13(16)14-6-2-4-8-17(14)20/h1,3,5,7,9-11,21H,2,4,6,8,19H2 |
| InChIKey | BNSSCYSXOVPFKS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|