C14H30O2Si2 — CID 11818518
(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol (PubChem CID 11818518) has the molecular formula C14H30O2Si2 and a molecular weight of 286.56 g/mol. Its IUPAC name is (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol.
| Compound Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 11818518 |
| Molecular Formula | C14H30O2Si2 |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-trimethylsilylpent-1-yn-3-ol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C14H30O2Si2/c1-12(13(15)10-11-17(5,6)7)16-18(8,9)14(2,3)4/h12-13,15H,1-9H3/t12-,13+/m0/s1 |
| InChIKey | RIOWUTKMEHHLGG-QWHCGFSZSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|