About 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine
2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine (PubChem CID 118185216) has the molecular formula C6H4Cl2F3N
and a molecular weight of 218.01 g/mol. Its IUPAC name is 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine |
| PubChem CID | 118185216 |
| Molecular Formula | C6H4Cl2F3N |
| Molecular Weight | 218.01 g/mol |
| Exact Mass | 216.97 |
| IUPAC Name | 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine |
| SMILES | FC(F)(F)C1=C(Cl)NC(Cl)C=C1 |
| InChI | InChI=1S/C6H4Cl2F3N/c7-4-2-1-3(5(8)12-4)6(9,10)11/h1-2,4,12H |
| InChIKey | QLTHKCYVDXBUOE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.01 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine?
The IUPAC name of 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine (CID 118185216) is 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine.
What is the SMILES notation for 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine?
The canonical SMILES for 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine is FC(F)(F)C1=C(Cl)NC(Cl)C=C1.
What is the InChIKey of 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine?
The InChIKey is QLTHKCYVDXBUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2F3N/c7-4-2-1-3(5(8)12-4)6(9,10)11/h1-2,4,12H.
What are the key properties of 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine?
2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine has a molecular weight of 218.01 g/mol, XLogP of 2.72, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-5-(trifluoromethyl)-1,2-dihydropyridine is sourced from PubChem (CID 118185216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).