C19H23N3O4S — CID 118185427
cis-(1R,2S)-2-[[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 118185427) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2S)-2-[[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118185427 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | cis-(1R,2S)-2-[[3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1noc(-c2c(NC(=O)[C@H]3CCCC[C@H]3C(=O)O)sc3c2CCCC3)n1 |
| InChI | InChI=1S/C19H23N3O4S/c1-10-20-17(26-22-10)15-13-8-4-5-9-14(13)27-18(15)21-16(23)11-6-2-3-7-12(11)19(24)25/h11-12H,2-9H2,1H3,(H,21,23)(H,24,25)/t11-,12+/m0/s1 |
| InChIKey | DNXAITYNLMDHGE-NWDGAFQWSA-N |
| XLogP | 3.81 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |