About 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide
2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide (PubChem CID 118185625) has the molecular formula C19H33NO2S
and a molecular weight of 339.55 g/mol. Its IUPAC name is 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide |
| PubChem CID | 118185625 |
| Molecular Formula | C19H33NO2S |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N(C)CC(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H33NO2S/c1-14(2)15-10-11-17(16(12-15)19(6,7)8)23(21,22)20(9)13-18(3,4)5/h10-12,14H,13H2,1-9H3 |
| InChIKey | OBXUEGNJJOAJLF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide?
The IUPAC name of 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide (CID 118185625) is 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide.
What is the SMILES notation for 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide?
The canonical SMILES for 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide is CC(C)c1ccc(S(=O)(=O)N(C)CC(C)(C)C)c(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide?
The InChIKey is OBXUEGNJJOAJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33NO2S/c1-14(2)15-10-11-17(16(12-15)19(6,7)8)23(21,22)20(9)13-18(3,4)5/h10-12,14H,13H2,1-9H3.
What are the key properties of 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide?
2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide has a molecular weight of 339.55 g/mol, XLogP of 4.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-(2,2-dimethylpropyl)-N-methyl-4-propan-2-ylbenzenesulfonamide is sourced from PubChem (CID 118185625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).