C28H41N3O2S — CID 118185745
N-cyclobutyl-4-(cyclohexylmethyl)-5-(2,6-ditert-butyl-1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carboxamide (PubChem CID 118185745) has the molecular formula C28H41N3O2S and a molecular weight of 483.72 g/mol. Its IUPAC name is N-cyclobutyl-4-(cyclohexylmethyl)-5-(2,6-ditert-butyl-1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-cyclobutyl-4-(cyclohexylmethyl)-5-(2,6-ditert-butyl-1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 118185745 |
| Molecular Formula | C28H41N3O2S |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-cyclobutyl-4-(cyclohexylmethyl)-5-(2,6-ditert-butyl-1-oxidopyridin-1-ium-4-yl)-1,3-thiazole-2-carboxamide |
| SMILES | CC(C)(C)c1cc(-c2sc(C(=O)NC3CCC3)nc2CC2CCCCC2)cc(C(C)(C)C)[n+]1[O-] |
| InChI | InChI=1S/C28H41N3O2S/c1-27(2,3)22-16-19(17-23(31(22)33)28(4,5)6)24-21(15-18-11-8-7-9-12-18)30-26(34-24)25(32)29-20-13-10-14-20/h16-18,20H,7-15H2,1-6H3,(H,29,32) |
| InChIKey | RMGNKSLXGBISAO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|