C22H31NO3 — CID 118186525
2-[[4-[cyclohexyl(hydroxy)methyl]cyclohexyl]methyl]-6-hydroxy-3H-isoindol-1-one (PubChem CID 118186525) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 2-[[4-[cyclohexyl(hydroxy)methyl]cyclohexyl]methyl]-6-hydroxy-3H-isoindol-1-one.
| Compound Name | 2-[[4-[cyclohexyl(hydroxy)methyl]cyclohexyl]methyl]-6-hydroxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 118186525 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 2-[[4-[cyclohexyl(hydroxy)methyl]cyclohexyl]methyl]-6-hydroxy-3H-isoindol-1-one |
| SMILES | O=C1c2cc(O)ccc2CN1CC1CCC(C(O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C22H31NO3/c24-19-11-10-18-14-23(22(26)20(18)12-19)13-15-6-8-17(9-7-15)21(25)16-4-2-1-3-5-16/h10-12,15-17,21,24-25H,1-9,13-14H2 |
| InChIKey | HRPLLSZRLXIDON-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |