C14H22O2 — CID 118186693
(1R,7aR)-1-butoxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 118186693) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1R,7aR)-1-butoxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | (1R,7aR)-1-butoxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 118186693 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1R,7aR)-1-butoxy-7a-methyl-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | CCCCO[C@@H]1CCC2=CC(=O)CC[C@]21C |
| InChI | InChI=1S/C14H22O2/c1-3-4-9-16-13-6-5-11-10-12(15)7-8-14(11,13)2/h10,13H,3-9H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | ITAOBDLSYSZKHM-ZIAGYGMSSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|