C12H18N2 — CID 118186753
(1E,3E)-N-methyl-N'-[(2E)-4-methylidenehexa-2,5-dien-3-yl]buta-1,3-diene-1,4-diamine (PubChem CID 118186753) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (1E,3E)-N-methyl-N'-[(2E)-4-methylidenehexa-2,5-dien-3-yl]buta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-N-methyl-N'-[(2E)-4-methylidenehexa-2,5-dien-3-yl]buta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 118186753 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (1E,3E)-N-methyl-N'-[(2E)-4-methylidenehexa-2,5-dien-3-yl]buta-1,3-diene-1,4-diamine |
| SMILES | C=CC(=C)/C(=C\C)N/C=C/C=C/NC |
| InChI | InChI=1S/C12H18N2/c1-5-11(3)12(6-2)14-10-8-7-9-13-4/h5-10,13-14H,1,3H2,2,4H3/b9-7+,10-8+,12-6+ |
| InChIKey | MMGNHHZKYZCCOZ-VEAKRQNZSA-N |
| XLogP | 2.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|