C16H25NO3 — CID 118186910
[(1R,2R)-2-pent-2-ynylcyclopropyl] N-[(3S)-2-hydroxy-4,4-dimethylpent-1-en-3-yl]carbamate (PubChem CID 118186910) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is [(1R,2R)-2-pent-2-ynylcyclopropyl] N-[(3S)-2-hydroxy-4,4-dimethylpent-1-en-3-yl]carbamate.
| Compound Name | [(1R,2R)-2-pent-2-ynylcyclopropyl] N-[(3S)-2-hydroxy-4,4-dimethylpent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 118186910 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [(1R,2R)-2-pent-2-ynylcyclopropyl] N-[(3S)-2-hydroxy-4,4-dimethylpent-1-en-3-yl]carbamate |
| SMILES | C=C(O)[C@@H](NC(=O)O[C@@H]1C[C@H]1CC#CCC)C(C)(C)C |
| InChI | InChI=1S/C16H25NO3/c1-6-7-8-9-12-10-13(12)20-15(19)17-14(11(2)18)16(3,4)5/h12-14,18H,2,6,9-10H2,1,3-5H3,(H,17,19)/t12-,13-,14-/m1/s1 |
| InChIKey | DIEWHNIQVVFDJK-MGPQQGTHSA-N |
| XLogP | 3.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|