C37H38ClN5O4S2 — CID 118187937
methyl N-[(2S)-1-[2-[2-[(2R,5R,6S)-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)sulfanylmethyl]-5-methylmorpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 118187937) has the molecular formula C37H38ClN5O4S2 and a molecular weight of 716.33 g/mol. Its IUPAC name is methyl N-[(2S)-1-[2-[2-[(2R,5R,6S)-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)sulfanylmethyl]-5-methylmorpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[2-[2-[(2R,5R,6S)-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)sulfanylmethyl]-5-methylmorpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 118187937 |
| Molecular Formula | C37H38ClN5O4S2 |
| Molecular Weight | 716.33 g/mol |
| Exact Mass | 715.21 |
| IUPAC Name | methyl N-[(2S)-1-[2-[2-[(2R,5R,6S)-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)sulfanylmethyl]-5-methylmorpholin-2-yl]ethyl]anilino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)Nc1ccccc1CC[C@@H]1CN[C@H](C)[C@@H](CSc2nc3ccc(Cl)nc3s2)O1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H38ClN5O4S2/c1-23-30(22-48-37-41-29-19-20-31(38)42-35(29)49-37)47-27(21-39-23)18-17-24-11-9-10-16-28(24)40-34(44)33(43-36(45)46-2)32(25-12-5-3-6-13-25)26-14-7-4-8-15-26/h3-16,19-20,23,27,30,32-33,39H,17-18,21-22H2,1-2H3,(H,40,44)(H,43,45)/t23-,27-,30-,33+/m1/s1 |
| InChIKey | FCQXZHFLECKUPK-WYBKINMVSA-N |
| XLogP | 7.31 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.33 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|