About [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate
[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate (PubChem CID 118188213) has the molecular formula C11H19N5O3
and a molecular weight of 269.31 g/mol. Its IUPAC name is [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate |
| PubChem CID | 118188213 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)COc1nc(N)nc(OC(=O)N(C)C)c1N |
| InChI | InChI=1S/C11H19N5O3/c1-6(2)5-18-8-7(12)9(15-10(13)14-8)19-11(17)16(3)4/h6H,5,12H2,1-4H3,(H2,13,14,15) |
| InChIKey | UDWDAIHQSMSOOB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate?
The IUPAC name of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate (CID 118188213) is [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate?
The canonical SMILES for [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate is CC(C)COc1nc(N)nc(OC(=O)N(C)C)c1N.
What is the InChIKey of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate?
The InChIKey is UDWDAIHQSMSOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O3/c1-6(2)5-18-8-7(12)9(15-10(13)14-8)19-11(17)16(3)4/h6H,5,12H2,1-4H3,(H2,13,14,15).
What are the key properties of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate?
[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate has a molecular weight of 269.31 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 118188213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).