C11H17N3O2 — CID 118188255
2-ethyl-N-hydroxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-carboxamide (PubChem CID 118188255) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-ethyl-N-hydroxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-carboxamide.
| Compound Name | 2-ethyl-N-hydroxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-carboxamide |
|---|---|
| PubChem CID | 118188255 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2-ethyl-N-hydroxy-1,3,4,5-tetrahydropyrrolo[1,2-a][1,4]diazepine-8-carboxamide |
| SMILES | CCN1CCCn2cc(C(=O)NO)cc2C1 |
| InChI | InChI=1S/C11H17N3O2/c1-2-13-4-3-5-14-7-9(11(15)12-16)6-10(14)8-13/h6-7,16H,2-5,8H2,1H3,(H,12,15) |
| InChIKey | KXNMIAHMMFFPPO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|