C14H26N2 — CID 118188486
(Z)-2,2,6,6-tetramethyl-5-prop-1-en-2-yliminohept-3-en-3-amine (PubChem CID 118188486) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is (Z)-2,2,6,6-tetramethyl-5-prop-1-en-2-yliminohept-3-en-3-amine.
| Compound Name | (Z)-2,2,6,6-tetramethyl-5-prop-1-en-2-yliminohept-3-en-3-amine |
|---|---|
| PubChem CID | 118188486 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (Z)-2,2,6,6-tetramethyl-5-prop-1-en-2-yliminohept-3-en-3-amine |
| SMILES | C=C(C)/N=C(/C=C(\N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26N2/c1-10(2)16-12(14(6,7)8)9-11(15)13(3,4)5/h9H,1,15H2,2-8H3/b11-9-,16-12- |
| InChIKey | GFFSMZRLQCZBTL-PCZLWNAYSA-N |
| XLogP | 3.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|