C15H27N — CID 118188701
(4Z,6E)-2,2,5,7,8,8-hexamethylnona-4,6-dien-3-imine (PubChem CID 118188701) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (4Z,6E)-2,2,5,7,8,8-hexamethylnona-4,6-dien-3-imine.
| Compound Name | (4Z,6E)-2,2,5,7,8,8-hexamethylnona-4,6-dien-3-imine |
|---|---|
| PubChem CID | 118188701 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (4Z,6E)-2,2,5,7,8,8-hexamethylnona-4,6-dien-3-imine |
| SMILES | [H]/N=C(\C=C(C)/C=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-11(9-12(2)14(3,4)5)10-13(16)15(6,7)8/h9-10,16H,1-8H3/b11-10-,12-9+,16-13+ |
| InChIKey | HLMUFZQWSNEUHC-UYQQDXDZSA-N |
| XLogP | 4.99 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|