C7H9FN2O2 — CID 118189455
(3R)-3-(1-fluoroethyl)-6-methylidenepiperazine-2,5-dione (PubChem CID 118189455) has the molecular formula C7H9FN2O2 and a molecular weight of 172.16 g/mol. Its IUPAC name is (3R)-3-(1-fluoroethyl)-6-methylidenepiperazine-2,5-dione.
| Compound Name | (3R)-3-(1-fluoroethyl)-6-methylidenepiperazine-2,5-dione |
|---|---|
| PubChem CID | 118189455 |
| Molecular Formula | C7H9FN2O2 |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (3R)-3-(1-fluoroethyl)-6-methylidenepiperazine-2,5-dione |
| SMILES | C=C1NC(=O)[C@H](C(C)F)NC1=O |
| InChI | InChI=1S/C7H9FN2O2/c1-3(8)5-7(12)9-4(2)6(11)10-5/h3,5H,2H2,1H3,(H,9,12)(H,10,11)/t3?,5-/m0/s1 |
| InChIKey | PIJPZJUZUWADCI-PVPKANODSA-N |
| XLogP | -0.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|