C20H20F4N6O4S — CID 118189959
N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide (PubChem CID 118189959) has the molecular formula C20H20F4N6O4S and a molecular weight of 516.48 g/mol. Its IUPAC name is N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide.
| Compound Name | N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 118189959 |
| Molecular Formula | C20H20F4N6O4S |
| Molecular Weight | 516.48 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | N-[3-[(8R)-6-amino-5,8-dimethyl-4,4-dioxo-4λ6-thia-5,7-diazaspiro[2.5]oct-6-en-8-yl]-4-fluorophenyl]-5-(2,2,2-trifluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CN1C(N)=N[C@](C)(c2cc(NC(=O)c3cnc(OCC(F)(F)F)cn3)ccc2F)C2(CC2)S1(=O)=O |
| InChI | InChI=1S/C20H20F4N6O4S/c1-18(19(5-6-19)35(32,33)30(2)17(25)29-18)12-7-11(3-4-13(12)21)28-16(31)14-8-27-15(9-26-14)34-10-20(22,23)24/h3-4,7-9H,5-6,10H2,1-2H3,(H2,25,29)(H,28,31)/t18-/m1/s1 |
| InChIKey | NGKDQMRAUSDSAI-GOSISDBHSA-N |
| XLogP | 2.15 |
| TPSA | 139.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |