About 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine
1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine (PubChem CID 118190293) has the molecular formula C19H26FN3OS
and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine |
| PubChem CID | 118190293 |
| Molecular Formula | C19H26FN3OS |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine |
| SMILES | CCOc1ncc(CN2CCC(N(C)Cc3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C19H26FN3OS/c1-3-24-19-21-12-18(25-19)14-23-10-8-17(9-11-23)22(2)13-15-4-6-16(20)7-5-15/h4-7,12,17H,3,8-11,13-14H2,1-2H3 |
| InChIKey | FGUDGGFENFCQMY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine?
The IUPAC name of 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine (CID 118190293) is 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine.
What is the SMILES notation for 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine?
The canonical SMILES for 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine is CCOc1ncc(CN2CCC(N(C)Cc3ccc(F)cc3)CC2)s1.
What is the InChIKey of 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine?
The InChIKey is FGUDGGFENFCQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26FN3OS/c1-3-24-19-21-12-18(25-19)14-23-10-8-17(9-11-23)22(2)13-15-4-6-16(20)7-5-15/h4-7,12,17H,3,8-11,13-14H2,1-2H3.
What are the key properties of 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine?
1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine has a molecular weight of 363.50 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-ethoxy-1,3-thiazol-5-yl)methyl]-N-[(4-fluorophenyl)methyl]-N-methylpiperidin-4-amine is sourced from PubChem (CID 118190293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).