C12H24N2O3 — CID 118190485
tert-butyl N-methyl-N-[2-[methyl-[[(2R)-oxiran-2-yl]methyl]amino]ethyl]carbamate (PubChem CID 118190485) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[methyl-[[(2R)-oxiran-2-yl]methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[methyl-[[(2R)-oxiran-2-yl]methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 118190485 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[methyl-[[(2R)-oxiran-2-yl]methyl]amino]ethyl]carbamate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)C[C@@H]1CO1 |
| InChI | InChI=1S/C12H24N2O3/c1-12(2,3)17-11(15)14(5)7-6-13(4)8-10-9-16-10/h10H,6-9H2,1-5H3/t10-/m1/s1 |
| InChIKey | GPAGSKJLFRBWRT-SNVBAGLBSA-N |
| XLogP | 1.18 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|