C18H24FN3S2 — CID 118190500
N-[(4-fluorophenyl)methyl]-N-methyl-1-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]piperidin-4-amine (PubChem CID 118190500) has the molecular formula C18H24FN3S2 and a molecular weight of 365.54 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-1-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]piperidin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-1-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 118190500 |
| Molecular Formula | C18H24FN3S2 |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-1-[(2-methylsulfanyl-1,3-thiazol-5-yl)methyl]piperidin-4-amine |
| SMILES | CSc1ncc(CN2CCC(N(C)Cc3ccc(F)cc3)CC2)s1 |
| InChI | InChI=1S/C18H24FN3S2/c1-21(12-14-3-5-15(19)6-4-14)16-7-9-22(10-8-16)13-17-11-20-18(23-2)24-17/h3-6,11,16H,7-10,12-13H2,1-2H3 |
| InChIKey | MNOGORCPSUFAGO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|