C14H15Cl2FN6O — CID 118190539
[(2S)-4-[5-amino-6-(2,3-dichloro-5-fluorophenyl)-1,2,4-triazin-3-yl]piperazin-2-yl]methanol (PubChem CID 118190539) has the molecular formula C14H15Cl2FN6O and a molecular weight of 373.22 g/mol. Its IUPAC name is [(2S)-4-[5-amino-6-(2,3-dichloro-5-fluorophenyl)-1,2,4-triazin-3-yl]piperazin-2-yl]methanol.
| Compound Name | [(2S)-4-[5-amino-6-(2,3-dichloro-5-fluorophenyl)-1,2,4-triazin-3-yl]piperazin-2-yl]methanol |
|---|---|
| PubChem CID | 118190539 |
| Molecular Formula | C14H15Cl2FN6O |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [(2S)-4-[5-amino-6-(2,3-dichloro-5-fluorophenyl)-1,2,4-triazin-3-yl]piperazin-2-yl]methanol |
| SMILES | Nc1nc(N2CCN[C@H](CO)C2)nnc1-c1cc(F)cc(Cl)c1Cl |
| InChI | InChI=1S/C14H15Cl2FN6O/c15-10-4-7(17)3-9(11(10)16)12-13(18)20-14(22-21-12)23-2-1-19-8(5-23)6-24/h3-4,8,19,24H,1-2,5-6H2,(H2,18,20,22)/t8-/m0/s1 |
| InChIKey | PMWKHHDFFWDJRF-QMMMGPOBSA-N |
| XLogP | 1.34 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|