C23H17N3O4 — CID 118190708
4-(8,8-dimethyl-4,6,11-trioxo-1,5,7,9-tetrahydrochromeno[3,2-f]indazol-5-yl)benzonitrile (PubChem CID 118190708) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is 4-(8,8-dimethyl-4,6,11-trioxo-1,5,7,9-tetrahydrochromeno[3,2-f]indazol-5-yl)benzonitrile.
| Compound Name | 4-(8,8-dimethyl-4,6,11-trioxo-1,5,7,9-tetrahydrochromeno[3,2-f]indazol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 118190708 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-(8,8-dimethyl-4,6,11-trioxo-1,5,7,9-tetrahydrochromeno[3,2-f]indazol-5-yl)benzonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)c3cn[nH]c3C1=O)C2c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H17N3O4/c1-23(2)7-14(27)17-15(8-23)30-22-18(16(17)12-5-3-11(9-24)4-6-12)20(28)13-10-25-26-19(13)21(22)29/h3-6,10,16H,7-8H2,1-2H3,(H,25,26) |
| InChIKey | SYDFTPDKBKFIFN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|