C10H14O — CID 118191387
(5S)-2,3,4,5-tetramethylcyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 118191387) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (5S)-2,3,4,5-tetramethylcyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | (5S)-2,3,4,5-tetramethylcyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 118191387 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (5S)-2,3,4,5-tetramethylcyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | CC1=C(C)[C@H](C)C(C=O)=C1C |
| InChI | InChI=1S/C10H14O/c1-6-7(2)9(4)10(5-11)8(6)3/h5,8H,1-4H3/t8-/m0/s1 |
| InChIKey | AZNZJHSDSBIICT-QMMMGPOBSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|