About 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine
6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 118191475) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 118191475 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | CCc1cnc2c(N)n[nH]c2c1 |
| InChI | InChI=1S/C8H10N4/c1-2-5-3-6-7(10-4-5)8(9)12-11-6/h3-4H,2H2,1H3,(H3,9,11,12) |
| InChIKey | KNZRICNSXNRJSZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine?
The IUPAC name of 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine (CID 118191475) is 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine is CCc1cnc2c(N)n[nH]c2c1.
What is the InChIKey of 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine?
The InChIKey is KNZRICNSXNRJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-2-5-3-6-7(10-4-5)8(9)12-11-6/h3-4H,2H2,1H3,(H3,9,11,12).
What are the key properties of 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine?
6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine has a molecular weight of 162.20 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1H-pyrazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 118191475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).