C24H24F6N2O7S — CID 118191574
3-[(2S,3R)-3-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid (PubChem CID 118191574) has the molecular formula C24H24F6N2O7S and a molecular weight of 598.52 g/mol. Its IUPAC name is 3-[(2S,3R)-3-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid.
| Compound Name | 3-[(2S,3R)-3-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 118191574 |
| Molecular Formula | C24H24F6N2O7S |
| Molecular Weight | 598.52 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | 3-[(2S,3R)-3-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
| SMILES | C[C@@H]1[C@H](CCC(=O)O)Oc2ccc(NC(=O)OC(C)(C)C(F)(F)F)cc2N1S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H24F6N2O7S/c1-13-18(9-10-20(33)34)38-19-8-7-15(31-21(35)39-22(2,3)24(28,29)30)12-17(19)32(13)40(36,37)16-6-4-5-14(11-16)23(25,26)27/h4-8,11-13,18H,9-10H2,1-3H3,(H,31,35)(H,33,34)/t13-,18+/m1/s1 |
| InChIKey | UNGZZEQWLAMTKW-ACJLOTCBSA-N |
| XLogP | 5.80 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |