C7H10O3 — CID 11819162
(3aS,7aR)-2,3,3a,4,7,7a-hexahydrofuro[3,2-c]pyran-6-one (PubChem CID 11819162) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (3aS,7aR)-2,3,3a,4,7,7a-hexahydrofuro[3,2-c]pyran-6-one.
| Compound Name | (3aS,7aR)-2,3,3a,4,7,7a-hexahydrofuro[3,2-c]pyran-6-one |
|---|---|
| PubChem CID | 11819162 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (3aS,7aR)-2,3,3a,4,7,7a-hexahydrofuro[3,2-c]pyran-6-one |
| SMILES | O=C1C[C@H]2OCC[C@H]2CO1 |
| InChI | InChI=1S/C7H10O3/c8-7-3-6-5(4-10-7)1-2-9-6/h5-6H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | YOUADLRUXRSAJM-NTSWFWBYSA-N |
| XLogP | 0.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |