C25H25F7N2O7S — CID 118191634
ethyl 3-[(2S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoate (PubChem CID 118191634) has the molecular formula C25H25F7N2O7S and a molecular weight of 630.54 g/mol. Its IUPAC name is ethyl 3-[(2S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoate.
| Compound Name | ethyl 3-[(2S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoate |
|---|---|
| PubChem CID | 118191634 |
| Molecular Formula | C25H25F7N2O7S |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | ethyl 3-[(2S)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1CN(S(=O)(=O)c2ccc(F)c(C(F)(F)F)c2)c2cc(NC(=O)OC(C)(C)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C25H25F7N2O7S/c1-4-39-21(35)10-6-15-13-34(42(37,38)16-7-8-18(26)17(12-16)24(27,28)29)19-11-14(5-9-20(19)40-15)33-22(36)41-23(2,3)25(30,31)32/h5,7-9,11-12,15H,4,6,10,13H2,1-3H3,(H,33,36)/t15-/m0/s1 |
| InChIKey | LXLFEHRARKKWRO-HNNXBMFYSA-N |
| XLogP | 6.03 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |