C26H29F3N2O7S — CID 118191658
(2R)-3-[(2S)-4-(3-cyclopropylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]-2-methylpropanoic acid (PubChem CID 118191658) has the molecular formula C26H29F3N2O7S and a molecular weight of 570.59 g/mol. Its IUPAC name is (2R)-3-[(2S)-4-(3-cyclopropylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]-2-methylpropanoic acid.
| Compound Name | (2R)-3-[(2S)-4-(3-cyclopropylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 118191658 |
| Molecular Formula | C26H29F3N2O7S |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (2R)-3-[(2S)-4-(3-cyclopropylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]-2-methylpropanoic acid |
| SMILES | C[C@H](C[C@H]1CN(S(=O)(=O)c2cccc(C3CC3)c2)c2cc(NC(=O)OC(C)(C)C(F)(F)F)ccc2O1)C(=O)O |
| InChI | InChI=1S/C26H29F3N2O7S/c1-15(23(32)33)11-19-14-31(39(35,36)20-6-4-5-17(12-20)16-7-8-16)21-13-18(9-10-22(21)37-19)30-24(34)38-25(2,3)26(27,28)29/h4-6,9-10,12-13,15-16,19H,7-8,11,14H2,1-3H3,(H,30,34)(H,32,33)/t15-,19+/m1/s1 |
| InChIKey | MHRJPEMOLWOENZ-BEFAXECRSA-N |
| XLogP | 5.52 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |