C24H27F3N2O7S — CID 118191660
(2S)-2-methyl-3-[(2S)-4-(3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid (PubChem CID 118191660) has the molecular formula C24H27F3N2O7S and a molecular weight of 544.55 g/mol. Its IUPAC name is (2S)-2-methyl-3-[(2S)-4-(3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid.
| Compound Name | (2S)-2-methyl-3-[(2S)-4-(3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 118191660 |
| Molecular Formula | C24H27F3N2O7S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | (2S)-2-methyl-3-[(2S)-4-(3-methylphenyl)sulfonyl-6-[(1,1,1-trifluoro-2-methylpropan-2-yl)oxycarbonylamino]-2,3-dihydro-1,4-benzoxazin-2-yl]propanoic acid |
| SMILES | Cc1cccc(S(=O)(=O)N2C[C@H](C[C@H](C)C(=O)O)Oc3ccc(NC(=O)OC(C)(C)C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C24H27F3N2O7S/c1-14-6-5-7-18(10-14)37(33,34)29-13-17(11-15(2)21(30)31)35-20-9-8-16(12-19(20)29)28-22(32)36-23(3,4)24(25,26)27/h5-10,12,15,17H,11,13H2,1-4H3,(H,28,32)(H,30,31)/t15-,17-/m0/s1 |
| InChIKey | YXIPJKULGMFUPK-RDJZCZTQSA-N |
| XLogP | 4.95 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |