C8H14O2 — CID 11819170
(4R,6R)-2-ethenyl-4,6-dimethyl-1,3-dioxane (PubChem CID 11819170) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (4R,6R)-2-ethenyl-4,6-dimethyl-1,3-dioxane.
| Compound Name | (4R,6R)-2-ethenyl-4,6-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 11819170 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (4R,6R)-2-ethenyl-4,6-dimethyl-1,3-dioxane |
| SMILES | C=CC1O[C@H](C)C[C@@H](C)O1 |
| InChI | InChI=1S/C8H14O2/c1-4-8-9-6(2)5-7(3)10-8/h4,6-8H,1,5H2,2-3H3/t6-,7-/m1/s1 |
| InChIKey | SNMZTSUCSDYFNN-RNFRBKRXSA-N |
| XLogP | 1.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|