C14H19N3O — CID 118191920
3-(6-amino-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-2,2-dimethylpropanenitrile (PubChem CID 118191920) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-(6-amino-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-2,2-dimethylpropanenitrile.
| Compound Name | 3-(6-amino-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 118191920 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-(6-amino-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-2,2-dimethylpropanenitrile |
| SMILES | CC1Nc2cc(N)ccc2OC1CC(C)(C)C#N |
| InChI | InChI=1S/C14H19N3O/c1-9-13(7-14(2,3)8-15)18-12-5-4-10(16)6-11(12)17-9/h4-6,9,13,17H,7,16H2,1-3H3 |
| InChIKey | SQKUOXXRIBWEPM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|