About CID 11819295
CID 11819295 (PubChem CID 11819295) has the molecular formula C4H7LiO2S2
and a molecular weight of 158.17 g/mol.
Molecular Properties
| Compound Name | CID 11819295 |
| PubChem CID | 11819295 |
| Molecular Formula | C4H7LiO2S2 |
| Molecular Weight | 158.17 g/mol |
| Exact Mass | 158.00 |
| IUPAC Name | — |
| SMILES | O=[S@]1[CH-][S@](=O)CCC1.[Li+] |
| InChI | InChI=1S/C4H7O2S2.Li/c5-7-2-1-3-8(6)4-7;/h4H,1-3H2;/q-1;+1/t7-,8-;/m1./s1 |
| InChIKey | JCCKLGLKZPSRPQ-SCLLHFNJSA-N |
| XLogP | -2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.17 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 11819295 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11819295?
The IUPAC name of CID 11819295 (CID 11819295) is not available.
What is the SMILES notation for CID 11819295?
The canonical SMILES for CID 11819295 is O=[S@]1[CH-][S@](=O)CCC1.[Li+].
What is the InChIKey of CID 11819295?
The InChIKey is JCCKLGLKZPSRPQ-SCLLHFNJSA-N. The full InChI is InChI=1S/C4H7O2S2.Li/c5-7-2-1-3-8(6)4-7;/h4H,1-3H2;/q-1;+1/t7-,8-;/m1./s1.
What are the key properties of CID 11819295?
CID 11819295 has a molecular weight of 158.17 g/mol, XLogP of -2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11819295 is sourced from PubChem (CID 11819295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).