About 4-cyano-2-methylbenzoic acid
4-cyano-2-methylbenzoic acid (PubChem CID 11819339) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-cyano-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 4-cyano-2-methylbenzoic acid |
| PubChem CID | 11819339 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 4-cyano-2-methylbenzoic acid |
| SMILES | Cc1cc(C#N)ccc1C(=O)O |
| InChI | InChI=1S/C9H7NO2/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4H,1H3,(H,11,12) |
| InChIKey | NIDKGLRXRBFGEN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyano-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2-methylbenzoic acid?
The IUPAC name of 4-cyano-2-methylbenzoic acid (CID 11819339) is 4-cyano-2-methylbenzoic acid.
What is the SMILES notation for 4-cyano-2-methylbenzoic acid?
The canonical SMILES for 4-cyano-2-methylbenzoic acid is Cc1cc(C#N)ccc1C(=O)O.
What is the InChIKey of 4-cyano-2-methylbenzoic acid?
The InChIKey is NIDKGLRXRBFGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-6-4-7(5-10)2-3-8(6)9(11)12/h2-4H,1H3,(H,11,12).
What are the key properties of 4-cyano-2-methylbenzoic acid?
4-cyano-2-methylbenzoic acid has a molecular weight of 161.16 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2-methylbenzoic acid is sourced from PubChem (CID 11819339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).