About N-ethylimidazo[1,2-a]pyrazin-8-amine
N-ethylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 11819354) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is N-ethylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | N-ethylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 11819354 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | N-ethylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCNc1nccn2ccnc12 |
| InChI | InChI=1S/C8H10N4/c1-2-9-7-8-11-4-6-12(8)5-3-10-7/h3-6H,2H2,1H3,(H,9,10) |
| InChIKey | XXUGLAFDUQERSL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of N-ethylimidazo[1,2-a]pyrazin-8-amine (CID 11819354) is N-ethylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for N-ethylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for N-ethylimidazo[1,2-a]pyrazin-8-amine is CCNc1nccn2ccnc12.
What is the InChIKey of N-ethylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is XXUGLAFDUQERSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-2-9-7-8-11-4-6-12(8)5-3-10-7/h3-6H,2H2,1H3,(H,9,10).
What are the key properties of N-ethylimidazo[1,2-a]pyrazin-8-amine?
N-ethylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 162.20 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 11819354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).