About 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one
5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one (PubChem CID 11819366) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 11819366 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1cc2[nH]c(=O)[nH]c2cc1O |
| InChI | InChI=1S/C8H8N2O2/c1-4-2-5-6(3-7(4)11)10-8(12)9-5/h2-3,11H,1H3,(H2,9,10,12) |
| InChIKey | LGANKRCXRCQIKL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one (CID 11819366) is 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one is Cc1cc2[nH]c(=O)[nH]c2cc1O.
What is the InChIKey of 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one?
The InChIKey is LGANKRCXRCQIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c1-4-2-5-6(3-7(4)11)10-8(12)9-5/h2-3,11H,1H3,(H2,9,10,12).
What are the key properties of 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one?
5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one has a molecular weight of 164.16 g/mol, XLogP of 0.87, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-6-methyl-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 11819366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).