About 2-methoxy-4,5-dimethylbenzaldehyde
2-methoxy-4,5-dimethylbenzaldehyde (PubChem CID 11819371) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 2-methoxy-4,5-dimethylbenzaldehyde |
| PubChem CID | 11819371 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-methoxy-4,5-dimethylbenzaldehyde |
| SMILES | COc1cc(C)c(C)cc1C=O |
| InChI | InChI=1S/C10H12O2/c1-7-4-9(6-11)10(12-3)5-8(7)2/h4-6H,1-3H3 |
| InChIKey | BFVZDEJGUQFXCV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4,5-dimethylbenzaldehyde?
The IUPAC name of 2-methoxy-4,5-dimethylbenzaldehyde (CID 11819371) is 2-methoxy-4,5-dimethylbenzaldehyde.
What is the SMILES notation for 2-methoxy-4,5-dimethylbenzaldehyde?
The canonical SMILES for 2-methoxy-4,5-dimethylbenzaldehyde is COc1cc(C)c(C)cc1C=O.
What is the InChIKey of 2-methoxy-4,5-dimethylbenzaldehyde?
The InChIKey is BFVZDEJGUQFXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-7-4-9(6-11)10(12-3)5-8(7)2/h4-6H,1-3H3.
What are the key properties of 2-methoxy-4,5-dimethylbenzaldehyde?
2-methoxy-4,5-dimethylbenzaldehyde has a molecular weight of 164.20 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4,5-dimethylbenzaldehyde is sourced from PubChem (CID 11819371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).