About 2-(methylamino)ethyl butanoate
2-(methylamino)ethyl butanoate (PubChem CID 118193831) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-(methylamino)ethyl butanoate.
Molecular Properties
| Compound Name | 2-(methylamino)ethyl butanoate |
| PubChem CID | 118193831 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 2-(methylamino)ethyl butanoate |
| SMILES | CCCC(=O)OCCNC |
| InChI | InChI=1S/C7H15NO2/c1-3-4-7(9)10-6-5-8-2/h8H,3-6H2,1-2H3 |
| InChIKey | GPIYRSCRNNBXNA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)ethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)ethyl butanoate?
The IUPAC name of 2-(methylamino)ethyl butanoate (CID 118193831) is 2-(methylamino)ethyl butanoate.
What is the SMILES notation for 2-(methylamino)ethyl butanoate?
The canonical SMILES for 2-(methylamino)ethyl butanoate is CCCC(=O)OCCNC.
What is the InChIKey of 2-(methylamino)ethyl butanoate?
The InChIKey is GPIYRSCRNNBXNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-3-4-7(9)10-6-5-8-2/h8H,3-6H2,1-2H3.
What are the key properties of 2-(methylamino)ethyl butanoate?
2-(methylamino)ethyl butanoate has a molecular weight of 145.20 g/mol, XLogP of 0.55, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)ethyl butanoate is sourced from PubChem (CID 118193831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).