About 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine
4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine (PubChem CID 11819394) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine |
| PubChem CID | 11819394 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine |
| SMILES | COc1ccc(N(C)C)c(N)c1 |
| InChI | InChI=1S/C9H14N2O/c1-11(2)9-5-4-7(12-3)6-8(9)10/h4-6H,10H2,1-3H3 |
| InChIKey | YEGNBGWUKGEOAJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine?
The IUPAC name of 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine (CID 11819394) is 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine.
What is the SMILES notation for 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine?
The canonical SMILES for 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine is COc1ccc(N(C)C)c(N)c1.
What is the InChIKey of 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine?
The InChIKey is YEGNBGWUKGEOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-11(2)9-5-4-7(12-3)6-8(9)10/h4-6H,10H2,1-3H3.
What are the key properties of 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine?
4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine has a molecular weight of 166.22 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1-N,1-N-dimethylbenzene-1,2-diamine is sourced from PubChem (CID 11819394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).