C10H16O2 — CID 11819421
(2E,5E)-5-ethoxyocta-2,5,7-trien-4-ol (PubChem CID 11819421) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (2E,5E)-5-ethoxyocta-2,5,7-trien-4-ol.
| Compound Name | (2E,5E)-5-ethoxyocta-2,5,7-trien-4-ol |
|---|---|
| PubChem CID | 11819421 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (2E,5E)-5-ethoxyocta-2,5,7-trien-4-ol |
| SMILES | C=C/C=C(/OCC)C(O)/C=C/C |
| InChI | InChI=1S/C10H16O2/c1-4-7-9(11)10(8-5-2)12-6-3/h4-5,7-9,11H,2,6H2,1,3H3/b7-4+,10-8+ |
| InChIKey | MZIBOBOMYDIOBQ-DAAQNPAKSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|