About 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium
3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium (PubChem CID 11819501) has the molecular formula C7H9ClN2O
and a molecular weight of 173.61 g/mol. Its IUPAC name is 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium.
Molecular Properties
| Compound Name | 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium |
| PubChem CID | 11819501 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 173.61 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium |
| SMILES | Cc1nc(Cl)c(C)[15n+]([O-])c1C |
| InChI | InChI=1S/C7H9ClN2O/c1-4-5(2)10(11)6(3)7(8)9-4/h1-3H3/i10+1 |
| InChIKey | KREFTKKPDJLZFB-DETAZLGJSA-N |
| XLogP | 1.29 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.61 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium?
The IUPAC name of 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium (CID 11819501) is 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium.
What is the SMILES notation for 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium?
The canonical SMILES for 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium is Cc1nc(Cl)c(C)[15n+]([O-])c1C.
What is the InChIKey of 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium?
The InChIKey is KREFTKKPDJLZFB-DETAZLGJSA-N. The full InChI is InChI=1S/C7H9ClN2O/c1-4-5(2)10(11)6(3)7(8)9-4/h1-3H3/i10+1.
What are the key properties of 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium?
3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium has a molecular weight of 173.61 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5,6-trimethyl-1-oxido(115N)pyrazin-1-ium is sourced from PubChem (CID 11819501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).