C22H18F5N5O2 — CID 118195190
6-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide (PubChem CID 118195190) has the molecular formula C22H18F5N5O2 and a molecular weight of 479.41 g/mol. Its IUPAC name is 6-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide.
| Compound Name | 6-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 118195190 |
| Molecular Formula | C22H18F5N5O2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 6-[(3R)-3-hydroxypyrrolidin-1-yl]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-5-pyrimidin-5-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)C(F)(F)F)cc1)c1cnc(N2CC[C@@H](O)C2)c(-c2cncnc2)c1 |
| InChI | InChI=1S/C22H18F5N5O2/c23-21(24,22(25,26)27)15-1-3-16(4-2-15)31-20(34)13-7-18(14-8-28-12-29-9-14)19(30-10-13)32-6-5-17(33)11-32/h1-4,7-10,12,17,33H,5-6,11H2,(H,31,34)/t17-/m1/s1 |
| InChIKey | XJCKZYFEKREOHG-QGZVFWFLSA-N |
| XLogP | 4.02 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|