C22H19ClF2N4O4 — CID 118195281
N-[4-[chloro(difluoro)methoxy]phenyl]-4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-pyrimidin-5-ylbenzamide (PubChem CID 118195281) has the molecular formula C22H19ClF2N4O4 and a molecular weight of 476.87 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-pyrimidin-5-ylbenzamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-pyrimidin-5-ylbenzamide |
|---|---|
| PubChem CID | 118195281 |
| Molecular Formula | C22H19ClF2N4O4 |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-3-pyrimidin-5-ylbenzamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)Cl)cc1)c1ccc(N2C[C@H](O)[C@@H](O)C2)c(-c2cncnc2)c1 |
| InChI | InChI=1S/C22H19ClF2N4O4/c23-22(24,25)33-16-4-2-15(3-5-16)28-21(32)13-1-6-18(29-10-19(30)20(31)11-29)17(7-13)14-8-26-12-27-9-14/h1-9,12,19-20,30-31H,10-11H2,(H,28,32)/t19-,20-/m0/s1 |
| InChIKey | PCIILKPGWCOWJP-PMACEKPBSA-N |
| XLogP | 3.11 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|