About 2,3,4-tribromofuran
2,3,4-tribromofuran (PubChem CID 118195496) has the molecular formula C4HBr3O
and a molecular weight of 304.76 g/mol. Its IUPAC name is 2,3,4-tribromofuran.
Molecular Properties
| Compound Name | 2,3,4-tribromofuran |
| PubChem CID | 118195496 |
| Molecular Formula | C4HBr3O |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 301.76 |
| IUPAC Name | 2,3,4-tribromofuran |
| SMILES | Brc1coc(Br)c1Br |
| InChI | InChI=1S/C4HBr3O/c5-2-1-8-4(7)3(2)6/h1H |
| InChIKey | KWGRCOXBUFDNRX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-tribromofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-tribromofuran?
The IUPAC name of 2,3,4-tribromofuran (CID 118195496) is 2,3,4-tribromofuran.
What is the SMILES notation for 2,3,4-tribromofuran?
The canonical SMILES for 2,3,4-tribromofuran is Brc1coc(Br)c1Br.
What is the InChIKey of 2,3,4-tribromofuran?
The InChIKey is KWGRCOXBUFDNRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HBr3O/c5-2-1-8-4(7)3(2)6/h1H.
What are the key properties of 2,3,4-tribromofuran?
2,3,4-tribromofuran has a molecular weight of 304.76 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-tribromofuran is sourced from PubChem (CID 118195496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).