C12H12F5NO4P+ — CID 118196154
oxo-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]-(2,3,4,5,6-pentafluorophenoxy)phosphanium (PubChem CID 118196154) has the molecular formula C12H12F5NO4P+ and a molecular weight of 360.20 g/mol. Its IUPAC name is oxo-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]-(2,3,4,5,6-pentafluorophenoxy)phosphanium.
| Compound Name | oxo-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]-(2,3,4,5,6-pentafluorophenoxy)phosphanium |
|---|---|
| PubChem CID | 118196154 |
| Molecular Formula | C12H12F5NO4P+ |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | oxo-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]-(2,3,4,5,6-pentafluorophenoxy)phosphanium |
| SMILES | CC(C)OC(=O)C(C)N[P+](=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H12F5NO4P/c1-4(2)21-12(19)5(3)18-23(20)22-11-9(16)7(14)6(13)8(15)10(11)17/h4-5H,1-3H3,(H,18,20)/q+1 |
| InChIKey | MEARLNKQQJMXFA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|