About methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate
methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate (PubChem CID 118196514) has the molecular formula C17H15ClFN5O2
and a molecular weight of 375.79 g/mol. Its IUPAC name is methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate.
Molecular Properties
| Compound Name | methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate |
| PubChem CID | 118196514 |
| Molecular Formula | C17H15ClFN5O2 |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate |
| SMILES | COC(=O)c1cccc(Nc2cc(-c3c(C)nnn3C)cnc2Cl)c1F |
| InChI | InChI=1S/C17H15ClFN5O2/c1-9-15(24(2)23-22-9)10-7-13(16(18)20-8-10)21-12-6-4-5-11(14(12)19)17(25)26-3/h4-8,21H,1-3H3 |
| InChIKey | IATWINZIHFZJDV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate?
The IUPAC name of methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate (CID 118196514) is methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate.
What is the SMILES notation for methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate?
The canonical SMILES for methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate is COC(=O)c1cccc(Nc2cc(-c3c(C)nnn3C)cnc2Cl)c1F.
What is the InChIKey of methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate?
The InChIKey is IATWINZIHFZJDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClFN5O2/c1-9-15(24(2)23-22-9)10-7-13(16(18)20-8-10)21-12-6-4-5-11(14(12)19)17(25)26-3/h4-8,21H,1-3H3.
What are the key properties of methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate?
methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate has a molecular weight of 375.79 g/mol, XLogP of 3.51, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-chloro-5-(3,5-dimethyltriazol-4-yl)-3-pyridinyl]amino]-2-fluorobenzoate is sourced from PubChem (CID 118196514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).