C24H22ClN3O5S — CID 118197461
4-tert-butyl-N-[7-chloro-2-(6-methoxy-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide (PubChem CID 118197461) has the molecular formula C24H22ClN3O5S and a molecular weight of 499.98 g/mol. Its IUPAC name is 4-tert-butyl-N-[7-chloro-2-(6-methoxy-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[7-chloro-2-(6-methoxy-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 118197461 |
| Molecular Formula | C24H22ClN3O5S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 4-tert-butyl-N-[7-chloro-2-(6-methoxy-3-pyridinyl)-1,3-dioxoisoindol-4-yl]benzenesulfonamide |
| SMILES | COc1ccc(N2C(=O)c3c(Cl)ccc(NS(=O)(=O)c4ccc(C(C)(C)C)cc4)c3C2=O)cn1 |
| InChI | InChI=1S/C24H22ClN3O5S/c1-24(2,3)14-5-8-16(9-6-14)34(31,32)27-18-11-10-17(25)20-21(18)23(30)28(22(20)29)15-7-12-19(33-4)26-13-15/h5-13,27H,1-4H3 |
| InChIKey | FDNHELFSRJUTAS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|