C10H13F2NO2 — CID 118197603
(6R,7R,8S)-8-(3,3-difluoroprop-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol (PubChem CID 118197603) has the molecular formula C10H13F2NO2 and a molecular weight of 217.22 g/mol. Its IUPAC name is (6R,7R,8S)-8-(3,3-difluoroprop-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol.
| Compound Name | (6R,7R,8S)-8-(3,3-difluoroprop-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol |
|---|---|
| PubChem CID | 118197603 |
| Molecular Formula | C10H13F2NO2 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | (6R,7R,8S)-8-(3,3-difluoroprop-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol |
| SMILES | O[C@H]1[C@H](O)CNC2(CC2)[C@@H]1C#CC(F)F |
| InChI | InChI=1S/C10H13F2NO2/c11-8(12)2-1-6-9(15)7(14)5-13-10(6)3-4-10/h6-9,13-15H,3-5H2/t6-,7-,9-/m1/s1 |
| InChIKey | ZTOJJKUWDSLXKW-ZXFLCMHBSA-N |
| XLogP | -0.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|